About cyclopenta-1,3-dien-1-yl(piperazin-1-yl)methanone
cyclopenta-1,3-dien-1-yl(piperazin-1-yl)methanone (PubChem CID 23543763) has the molecular formula C10H14N2O
and a molecular weight of 178.24 g/mol. Its IUPAC name is cyclopenta-1,3-dien-1-yl(piperazin-1-yl)methanone.
Molecular Properties
| Compound Name | cyclopenta-1,3-dien-1-yl(piperazin-1-yl)methanone |
| PubChem CID | 23543763 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | cyclopenta-1,3-dien-1-yl(piperazin-1-yl)methanone |
| SMILES | O=C(C1=CC=CC1)N1CCNCC1 |
| InChI | InChI=1S/C10H14N2O/c13-10(9-3-1-2-4-9)12-7-5-11-6-8-12/h1-3,11H,4-8H2 |
| InChIKey | IJGJGEZQYRADHH-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopenta-1,3-dien-1-yl(piperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-dien-1-yl(piperazin-1-yl)methanone?
The IUPAC name of cyclopenta-1,3-dien-1-yl(piperazin-1-yl)methanone (CID 23543763) is cyclopenta-1,3-dien-1-yl(piperazin-1-yl)methanone.
What is the SMILES notation for cyclopenta-1,3-dien-1-yl(piperazin-1-yl)methanone?
The canonical SMILES for cyclopenta-1,3-dien-1-yl(piperazin-1-yl)methanone is O=C(C1=CC=CC1)N1CCNCC1.
What is the InChIKey of cyclopenta-1,3-dien-1-yl(piperazin-1-yl)methanone?
The InChIKey is IJGJGEZQYRADHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c13-10(9-3-1-2-4-9)12-7-5-11-6-8-12/h1-3,11H,4-8H2.
What are the key properties of cyclopenta-1,3-dien-1-yl(piperazin-1-yl)methanone?
cyclopenta-1,3-dien-1-yl(piperazin-1-yl)methanone has a molecular weight of 178.24 g/mol, XLogP of 0.30, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-dien-1-yl(piperazin-1-yl)methanone is sourced from PubChem (CID 23543763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).