C20H17F3N4O5 — CID 23543841
4-[4-(furan-2-carbonyl)piperazin-1-yl]-3-nitro-1-(2,2,2-trifluoroethyl)quinolin-2-one (PubChem CID 23543841) has the molecular formula C20H17F3N4O5 and a molecular weight of 450.37 g/mol. Its IUPAC name is 4-[4-(furan-2-carbonyl)piperazin-1-yl]-3-nitro-1-(2,2,2-trifluoroethyl)quinolin-2-one.
| Compound Name | 4-[4-(furan-2-carbonyl)piperazin-1-yl]-3-nitro-1-(2,2,2-trifluoroethyl)quinolin-2-one |
|---|---|
| PubChem CID | 23543841 |
| Molecular Formula | C20H17F3N4O5 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 4-[4-(furan-2-carbonyl)piperazin-1-yl]-3-nitro-1-(2,2,2-trifluoroethyl)quinolin-2-one |
| SMILES | O=C(c1ccco1)N1CCN(c2c([N+](=O)[O-])c(=O)n(CC(F)(F)F)c3ccccc23)CC1 |
| InChI | InChI=1S/C20H17F3N4O5/c21-20(22,23)12-26-14-5-2-1-4-13(14)16(17(19(26)29)27(30)31)24-7-9-25(10-8-24)18(28)15-6-3-11-32-15/h1-6,11H,7-10,12H2 |
| InChIKey | ZQTWWWIPWILKTM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 101.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|