About 4-ethyl-5-fluoro-2,6-dimethylpyrimidine
4-ethyl-5-fluoro-2,6-dimethylpyrimidine (PubChem CID 23544404) has the molecular formula C8H11FN2
and a molecular weight of 154.19 g/mol. Its IUPAC name is 4-ethyl-5-fluoro-2,6-dimethylpyrimidine.
Molecular Properties
| Compound Name | 4-ethyl-5-fluoro-2,6-dimethylpyrimidine |
| PubChem CID | 23544404 |
| Molecular Formula | C8H11FN2 |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 4-ethyl-5-fluoro-2,6-dimethylpyrimidine |
| SMILES | CCc1nc(C)nc(C)c1F |
| InChI | InChI=1S/C8H11FN2/c1-4-7-8(9)5(2)10-6(3)11-7/h4H2,1-3H3 |
| InChIKey | ASNWEZNLGJHGJK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-5-fluoro-2,6-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-5-fluoro-2,6-dimethylpyrimidine?
The IUPAC name of 4-ethyl-5-fluoro-2,6-dimethylpyrimidine (CID 23544404) is 4-ethyl-5-fluoro-2,6-dimethylpyrimidine.
What is the SMILES notation for 4-ethyl-5-fluoro-2,6-dimethylpyrimidine?
The canonical SMILES for 4-ethyl-5-fluoro-2,6-dimethylpyrimidine is CCc1nc(C)nc(C)c1F.
What is the InChIKey of 4-ethyl-5-fluoro-2,6-dimethylpyrimidine?
The InChIKey is ASNWEZNLGJHGJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FN2/c1-4-7-8(9)5(2)10-6(3)11-7/h4H2,1-3H3.
What are the key properties of 4-ethyl-5-fluoro-2,6-dimethylpyrimidine?
4-ethyl-5-fluoro-2,6-dimethylpyrimidine has a molecular weight of 154.19 g/mol, XLogP of 1.79, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-5-fluoro-2,6-dimethylpyrimidine is sourced from PubChem (CID 23544404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).