C17H35N — CID 23544585
N,4-ditert-butyl-3,3,5-trimethylcyclohexan-1-amine (PubChem CID 23544585) has the molecular formula C17H35N and a molecular weight of 253.47 g/mol. Its IUPAC name is N,4-ditert-butyl-3,3,5-trimethylcyclohexan-1-amine.
| Compound Name | N,4-ditert-butyl-3,3,5-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 23544585 |
| Molecular Formula | C17H35N |
| Molecular Weight | 253.47 g/mol |
| Exact Mass | 253.28 |
| IUPAC Name | N,4-ditert-butyl-3,3,5-trimethylcyclohexan-1-amine |
| SMILES | CC1CC(NC(C)(C)C)CC(C)(C)C1C(C)(C)C |
| InChI | InChI=1S/C17H35N/c1-12-10-13(18-16(5,6)7)11-17(8,9)14(12)15(2,3)4/h12-14,18H,10-11H2,1-9H3 |
| InChIKey | SIYDKVJCPXOXLM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |