C14H2F18O2 — CID 23544897
(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl) 2-(trifluoromethyl)prop-2-enoate (PubChem CID 23544897) has the molecular formula C14H2F18O2 and a molecular weight of 544.13 g/mol. Its IUPAC name is (2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl) 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | (2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl) 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 23544897 |
| Molecular Formula | C14H2F18O2 |
| Molecular Weight | 544.13 g/mol |
| Exact Mass | 543.98 |
| IUPAC Name | (2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl) 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC12C(F)(F)C3(F)C(F)(F)C(F)(C(F)(F)C(F)(C3(F)F)C1(F)F)C2(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H2F18O2/c1-2(4(15,16)17)3(33)34-8-12(27,28)5(18)9(21,22)6(19,13(8,29)30)11(25,26)7(20,10(5,23)24)14(8,31)32/h1H2 |
| InChIKey | HJNJYKRAJOCFSF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.13 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|