C15H8F14O2 — CID 23544905
(2-ethyl-1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-2-adamantyl) prop-2-enoate (PubChem CID 23544905) has the molecular formula C15H8F14O2 and a molecular weight of 486.20 g/mol. Its IUPAC name is (2-ethyl-1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-2-adamantyl) prop-2-enoate.
| Compound Name | (2-ethyl-1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-2-adamantyl) prop-2-enoate |
|---|---|
| PubChem CID | 23544905 |
| Molecular Formula | C15H8F14O2 |
| Molecular Weight | 486.20 g/mol |
| Exact Mass | 486.03 |
| IUPAC Name | (2-ethyl-1,3,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoro-2-adamantyl) prop-2-enoate |
| SMILES | C=CC(=O)OC1(CC)C2(F)C(F)(F)C3(F)C(F)(F)C(F)(C2(F)F)C(F)(F)C1(F)C3(F)F |
| InChI | InChI=1S/C15H8F14O2/c1-3-5(30)31-6(4-2)7(16)11(20,21)9(18)13(24,25)8(6,17)14(26,27)10(19,12(7,22)23)15(9,28)29/h3H,1,4H2,2H3 |
| InChIKey | YPNBKBDVMKDWOC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.20 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|