About 2-ethoxyethyl 3-[bis(2-acetyloxyethyl)amino]propanoate
2-ethoxyethyl 3-[bis(2-acetyloxyethyl)amino]propanoate (PubChem CID 23544927) has the molecular formula C15H27NO7
and a molecular weight of 333.38 g/mol. Its IUPAC name is 2-ethoxyethyl 3-[bis(2-acetyloxyethyl)amino]propanoate.
Molecular Properties
| Compound Name | 2-ethoxyethyl 3-[bis(2-acetyloxyethyl)amino]propanoate |
| PubChem CID | 23544927 |
| Molecular Formula | C15H27NO7 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 2-ethoxyethyl 3-[bis(2-acetyloxyethyl)amino]propanoate |
| SMILES | CCOCCOC(=O)CCN(CCOC(C)=O)CCOC(C)=O |
| InChI | InChI=1S/C15H27NO7/c1-4-20-11-12-23-15(19)5-6-16(7-9-21-13(2)17)8-10-22-14(3)18/h4-12H2,1-3H3 |
| InChIKey | SYXOMADZQILGKJ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyethyl 3-[bis(2-acetyloxyethyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyethyl 3-[bis(2-acetyloxyethyl)amino]propanoate?
The IUPAC name of 2-ethoxyethyl 3-[bis(2-acetyloxyethyl)amino]propanoate (CID 23544927) is 2-ethoxyethyl 3-[bis(2-acetyloxyethyl)amino]propanoate.
What is the SMILES notation for 2-ethoxyethyl 3-[bis(2-acetyloxyethyl)amino]propanoate?
The canonical SMILES for 2-ethoxyethyl 3-[bis(2-acetyloxyethyl)amino]propanoate is CCOCCOC(=O)CCN(CCOC(C)=O)CCOC(C)=O.
What is the InChIKey of 2-ethoxyethyl 3-[bis(2-acetyloxyethyl)amino]propanoate?
The InChIKey is SYXOMADZQILGKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO7/c1-4-20-11-12-23-15(19)5-6-16(7-9-21-13(2)17)8-10-22-14(3)18/h4-12H2,1-3H3.
What are the key properties of 2-ethoxyethyl 3-[bis(2-acetyloxyethyl)amino]propanoate?
2-ethoxyethyl 3-[bis(2-acetyloxyethyl)amino]propanoate has a molecular weight of 333.38 g/mol, XLogP of 0.38, 13 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyethyl 3-[bis(2-acetyloxyethyl)amino]propanoate is sourced from PubChem (CID 23544927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).