C10H10N4Na2O8S4 — CID 23545065
disodium;2-[5-(methanesulfonamido)-3-methylsulfanyl-1,2,4-triazol-1-yl]-4-oxidoperoxysulfanylbenzenesulfonate (PubChem CID 23545065) has the molecular formula C10H10N4Na2O8S4 and a molecular weight of 488.46 g/mol. Its IUPAC name is disodium;2-[5-(methanesulfonamido)-3-methylsulfanyl-1,2,4-triazol-1-yl]-4-oxidoperoxysulfanylbenzenesulfonate.
| Compound Name | disodium;2-[5-(methanesulfonamido)-3-methylsulfanyl-1,2,4-triazol-1-yl]-4-oxidoperoxysulfanylbenzenesulfonate |
|---|---|
| PubChem CID | 23545065 |
| Molecular Formula | C10H10N4Na2O8S4 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 487.92 |
| IUPAC Name | disodium;2-[5-(methanesulfonamido)-3-methylsulfanyl-1,2,4-triazol-1-yl]-4-oxidoperoxysulfanylbenzenesulfonate |
| SMILES | CSc1nc(NS(C)(=O)=O)n(-c2cc(SOO[O-])ccc2S(=O)(=O)[O-])n1.[Na+].[Na+] |
| InChI | InChI=1S/C10H12N4O8S4.2Na/c1-23-10-11-9(13-25(2,16)17)14(12-10)7-5-6(24-22-21-15)3-4-8(7)26(18,19)20;;/h3-5,15H,1-2H3,(H,11,12,13)(H,18,19,20);;/q;2*+1/p-2 |
| InChIKey | AVWMPZNMMHZQLJ-UHFFFAOYSA-L |
| XLogP | -6.50 |
| TPSA | 175.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | -6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|