C10H12N4O8S4 — CID 23545066
2-[5-(methanesulfonamido)-3-methylsulfanyl-1,2,4-triazol-1-yl]-4-(trioxidanylsulfanyl)benzenesulfonic acid (PubChem CID 23545066) has the molecular formula C10H12N4O8S4 and a molecular weight of 444.49 g/mol. Its IUPAC name is 2-[5-(methanesulfonamido)-3-methylsulfanyl-1,2,4-triazol-1-yl]-4-(trioxidanylsulfanyl)benzenesulfonic acid.
| Compound Name | 2-[5-(methanesulfonamido)-3-methylsulfanyl-1,2,4-triazol-1-yl]-4-(trioxidanylsulfanyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 23545066 |
| Molecular Formula | C10H12N4O8S4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 443.95 |
| IUPAC Name | 2-[5-(methanesulfonamido)-3-methylsulfanyl-1,2,4-triazol-1-yl]-4-(trioxidanylsulfanyl)benzenesulfonic acid |
| SMILES | CSc1nc(NS(C)(=O)=O)n(-c2cc(SOOO)ccc2S(=O)(=O)O)n1 |
| InChI | InChI=1S/C10H12N4O8S4/c1-23-10-11-9(13-25(2,16)17)14(12-10)7-5-6(24-22-21-15)3-4-8(7)26(18,19)20/h3-5,15H,1-2H3,(H,11,12,13)(H,18,19,20) |
| InChIKey | QBRYOMARWZAZNW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 169.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|