C28H36B2O4 — CID 23545264
4,4,5,5-tetramethyl-2-[9-propan-2-ylidene-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-1,3,2-dioxaborolane (PubChem CID 23545264) has the molecular formula C28H36B2O4 and a molecular weight of 458.22 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[9-propan-2-ylidene-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[9-propan-2-ylidene-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 23545264 |
| Molecular Formula | C28H36B2O4 |
| Molecular Weight | 458.22 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[9-propan-2-ylidene-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-1,3,2-dioxaborolane |
| SMILES | CC(C)=C1c2cc(B3OC(C)(C)C(C)(C)O3)ccc2-c2ccc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C28H36B2O4/c1-17(2)24-22-15-18(29-31-25(3,4)26(5,6)32-29)11-13-20(22)21-14-12-19(16-23(21)24)30-33-27(7,8)28(9,10)34-30/h11-16H,1-10H3 |
| InChIKey | APYSZHPOVMDOTB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.22 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|