C34H48B2O4 — CID 23545266
4,4,5,5-tetramethyl-2-[9-nonylidene-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-1,3,2-dioxaborolane (PubChem CID 23545266) has the molecular formula C34H48B2O4 and a molecular weight of 542.38 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[9-nonylidene-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[9-nonylidene-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 23545266 |
| Molecular Formula | C34H48B2O4 |
| Molecular Weight | 542.38 g/mol |
| Exact Mass | 542.37 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[9-nonylidene-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-1,3,2-dioxaborolane |
| SMILES | CCCCCCCCC=C1c2cc(B3OC(C)(C)C(C)(C)O3)ccc2-c2ccc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C34H48B2O4/c1-10-11-12-13-14-15-16-17-26-29-22-24(35-37-31(2,3)32(4,5)38-35)18-20-27(29)28-21-19-25(23-30(26)28)36-39-33(6,7)34(8,9)40-36/h17-23H,10-16H2,1-9H3 |
| InChIKey | HBDZFDJMWKABOO-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.38 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|