C20H19Cl2NO2 — CID 2354551
4-chloro-N-[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylbenzamide (PubChem CID 2354551) has the molecular formula C20H19Cl2NO2 and a molecular weight of 376.28 g/mol. Its IUPAC name is 4-chloro-N-[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylbenzamide.
| Compound Name | 4-chloro-N-[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 2354551 |
| Molecular Formula | C20H19Cl2NO2 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 4-chloro-N-[(1S)-1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(Cl)cc1)[C@]1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C20H19Cl2NO2/c1-23(19(25)14-9-11-15(21)12-10-14)20(13-5-4-8-18(20)24)16-6-2-3-7-17(16)22/h2-3,6-7,9-12H,4-5,8,13H2,1H3/t20-/m0/s1 |
| InChIKey | WBRNEIWXKCXAEB-FQEVSTJZSA-N |
| XLogP | 5.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |