About 7-methyl-6-propyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one
7-methyl-6-propyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 23545584) has the molecular formula C10H12N2OS
and a molecular weight of 208.29 g/mol. Its IUPAC name is 7-methyl-6-propyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 7-methyl-6-propyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| PubChem CID | 23545584 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 7-methyl-6-propyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CCCc1c(C)nc2sccn2c1=O |
| InChI | InChI=1S/C10H12N2OS/c1-3-4-8-7(2)11-10-12(9(8)13)5-6-14-10/h5-6H,3-4H2,1-2H3 |
| InChIKey | AYRWMQHFHBBTCC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methyl-6-propyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-6-propyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The IUPAC name of 7-methyl-6-propyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (CID 23545584) is 7-methyl-6-propyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
What is the SMILES notation for 7-methyl-6-propyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The canonical SMILES for 7-methyl-6-propyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one is CCCc1c(C)nc2sccn2c1=O.
What is the InChIKey of 7-methyl-6-propyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The InChIKey is AYRWMQHFHBBTCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2OS/c1-3-4-8-7(2)11-10-12(9(8)13)5-6-14-10/h5-6H,3-4H2,1-2H3.
What are the key properties of 7-methyl-6-propyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
7-methyl-6-propyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one has a molecular weight of 208.29 g/mol, XLogP of 2.02, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-6-propyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one is sourced from PubChem (CID 23545584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).