About 8-chloro-6-fluoro-7-hydroxy-4,9a-dimethyl-2,9-dihydro-1H-fluoren-3-one
8-chloro-6-fluoro-7-hydroxy-4,9a-dimethyl-2,9-dihydro-1H-fluoren-3-one (PubChem CID 23545794) has the molecular formula C15H14ClFO2
and a molecular weight of 280.73 g/mol. Its IUPAC name is 8-chloro-6-fluoro-7-hydroxy-4,9a-dimethyl-2,9-dihydro-1H-fluoren-3-one.
Molecular Properties
| Compound Name | 8-chloro-6-fluoro-7-hydroxy-4,9a-dimethyl-2,9-dihydro-1H-fluoren-3-one |
| PubChem CID | 23545794 |
| Molecular Formula | C15H14ClFO2 |
| Molecular Weight | 280.73 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 8-chloro-6-fluoro-7-hydroxy-4,9a-dimethyl-2,9-dihydro-1H-fluoren-3-one |
| SMILES | CC1=C2c3cc(F)c(O)c(Cl)c3CC2(C)CCC1=O |
| InChI | InChI=1S/C15H14ClFO2/c1-7-11(18)3-4-15(2)6-9-8(12(7)15)5-10(17)14(19)13(9)16/h5,19H,3-4,6H2,1-2H3 |
| InChIKey | PSBWMSPHYGZYOY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.73 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-chloro-6-fluoro-7-hydroxy-4,9a-dimethyl-2,9-dihydro-1H-fluoren-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-6-fluoro-7-hydroxy-4,9a-dimethyl-2,9-dihydro-1H-fluoren-3-one?
The IUPAC name of 8-chloro-6-fluoro-7-hydroxy-4,9a-dimethyl-2,9-dihydro-1H-fluoren-3-one (CID 23545794) is 8-chloro-6-fluoro-7-hydroxy-4,9a-dimethyl-2,9-dihydro-1H-fluoren-3-one.
What is the SMILES notation for 8-chloro-6-fluoro-7-hydroxy-4,9a-dimethyl-2,9-dihydro-1H-fluoren-3-one?
The canonical SMILES for 8-chloro-6-fluoro-7-hydroxy-4,9a-dimethyl-2,9-dihydro-1H-fluoren-3-one is CC1=C2c3cc(F)c(O)c(Cl)c3CC2(C)CCC1=O.
What is the InChIKey of 8-chloro-6-fluoro-7-hydroxy-4,9a-dimethyl-2,9-dihydro-1H-fluoren-3-one?
The InChIKey is PSBWMSPHYGZYOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClFO2/c1-7-11(18)3-4-15(2)6-9-8(12(7)15)5-10(17)14(19)13(9)16/h5,19H,3-4,6H2,1-2H3.
What are the key properties of 8-chloro-6-fluoro-7-hydroxy-4,9a-dimethyl-2,9-dihydro-1H-fluoren-3-one?
8-chloro-6-fluoro-7-hydroxy-4,9a-dimethyl-2,9-dihydro-1H-fluoren-3-one has a molecular weight of 280.73 g/mol, XLogP of 3.88, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-6-fluoro-7-hydroxy-4,9a-dimethyl-2,9-dihydro-1H-fluoren-3-one is sourced from PubChem (CID 23545794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).