C17H18F2N2O4 — CID 23546148
[(5R)-3-[3,5-difluoro-4-(1,2,3,6-tetrahydropyridin-6-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl acetate (PubChem CID 23546148) has the molecular formula C17H18F2N2O4 and a molecular weight of 352.34 g/mol. Its IUPAC name is [(5R)-3-[3,5-difluoro-4-(1,2,3,6-tetrahydropyridin-6-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl acetate.
| Compound Name | [(5R)-3-[3,5-difluoro-4-(1,2,3,6-tetrahydropyridin-6-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl acetate |
|---|---|
| PubChem CID | 23546148 |
| Molecular Formula | C17H18F2N2O4 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | [(5R)-3-[3,5-difluoro-4-(1,2,3,6-tetrahydropyridin-6-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1CN(c2cc(F)c(C3C=CCCN3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H18F2N2O4/c1-10(22)24-9-12-8-21(17(23)25-12)11-6-13(18)16(14(19)7-11)15-4-2-3-5-20-15/h2,4,6-7,12,15,20H,3,5,8-9H2,1H3/t12-,15?/m1/s1 |
| InChIKey | LRHVTRKOBMFUMY-KEKZHRQWSA-N |
| XLogP | 2.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|