About 3,8-dimethylimidazo[5,1-d][1,2,3,5]tetrazin-4-one
3,8-dimethylimidazo[5,1-d][1,2,3,5]tetrazin-4-one (PubChem CID 23546854) has the molecular formula C6H7N5O
and a molecular weight of 165.16 g/mol. Its IUPAC name is 3,8-dimethylimidazo[5,1-d][1,2,3,5]tetrazin-4-one.
Analyze 3,8-dimethylimidazo[5,1-d][1,2,3,5]tetrazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dimethylimidazo[5,1-d][1,2,3,5]tetrazin-4-one?
The IUPAC name of 3,8-dimethylimidazo[5,1-d][1,2,3,5]tetrazin-4-one (CID 23546854) is 3,8-dimethylimidazo[5,1-d][1,2,3,5]tetrazin-4-one.
What is the SMILES notation for 3,8-dimethylimidazo[5,1-d][1,2,3,5]tetrazin-4-one?
The canonical SMILES for 3,8-dimethylimidazo[5,1-d][1,2,3,5]tetrazin-4-one is Cc1ncn2c(=O)n(C)nnc12.
What is the InChIKey of 3,8-dimethylimidazo[5,1-d][1,2,3,5]tetrazin-4-one?
The InChIKey is SLYAKFNETBOCEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5O/c1-4-5-8-9-10(2)6(12)11(5)3-7-4/h3H,1-2H3.
What are the key properties of 3,8-dimethylimidazo[5,1-d][1,2,3,5]tetrazin-4-one?
3,8-dimethylimidazo[5,1-d][1,2,3,5]tetrazin-4-one has a molecular weight of 165.16 g/mol, XLogP of -0.87, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dimethylimidazo[5,1-d][1,2,3,5]tetrazin-4-one is sourced from PubChem (CID 23546854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).