About 4-(2-methylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one
4-(2-methylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 2354700) has the molecular formula C16H12N4O
and a molecular weight of 276.30 g/mol. Its IUPAC name is 4-(2-methylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
Molecular Properties
| Compound Name | 4-(2-methylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| PubChem CID | 2354700 |
| Molecular Formula | C16H12N4O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 4-(2-methylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | Cc1ccccc1-n1c(=O)c2ccccc2n2cnnc12 |
| InChI | InChI=1S/C16H12N4O/c1-11-6-2-4-8-13(11)20-15(21)12-7-3-5-9-14(12)19-10-17-18-16(19)20/h2-10H,1H3 |
| InChIKey | PGPCDIBJNJCRKO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2-methylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one?
The IUPAC name of 4-(2-methylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one (CID 2354700) is 4-(2-methylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
What is the SMILES notation for 4-(2-methylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one?
The canonical SMILES for 4-(2-methylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one is Cc1ccccc1-n1c(=O)c2ccccc2n2cnnc12.
What is the InChIKey of 4-(2-methylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one?
The InChIKey is PGPCDIBJNJCRKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4O/c1-11-6-2-4-8-13(11)20-15(21)12-7-3-5-9-14(12)19-10-17-18-16(19)20/h2-10H,1H3.
What are the key properties of 4-(2-methylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one?
4-(2-methylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one has a molecular weight of 276.30 g/mol, XLogP of 2.34, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylphenyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one is sourced from PubChem (CID 2354700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).