About 2-[4-(2,2-dimethylbutanoyloxy)-3,5-dimethylphenyl]-2-oxoacetate
2-[4-(2,2-dimethylbutanoyloxy)-3,5-dimethylphenyl]-2-oxoacetate (PubChem CID 23547451) has the molecular formula C16H19O5-
and a molecular weight of 291.32 g/mol. Its IUPAC name is 2-[4-(2,2-dimethylbutanoyloxy)-3,5-dimethylphenyl]-2-oxoacetate.
Molecular Properties
| Compound Name | 2-[4-(2,2-dimethylbutanoyloxy)-3,5-dimethylphenyl]-2-oxoacetate |
| PubChem CID | 23547451 |
| Molecular Formula | C16H19O5- |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-[4-(2,2-dimethylbutanoyloxy)-3,5-dimethylphenyl]-2-oxoacetate |
| SMILES | CCC(C)(C)C(=O)Oc1c(C)cc(C(=O)C(=O)[O-])cc1C |
| InChI | InChI=1S/C16H20O5/c1-6-16(4,5)15(20)21-13-9(2)7-11(8-10(13)3)12(17)14(18)19/h7-8H,6H2,1-5H3,(H,18,19)/p-1 |
| InChIKey | GCVGMGXGHGVAAT-UHFFFAOYSA-M |
| XLogP | 1.58 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2,2-dimethylbutanoyloxy)-3,5-dimethylphenyl]-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,2-dimethylbutanoyloxy)-3,5-dimethylphenyl]-2-oxoacetate?
The IUPAC name of 2-[4-(2,2-dimethylbutanoyloxy)-3,5-dimethylphenyl]-2-oxoacetate (CID 23547451) is 2-[4-(2,2-dimethylbutanoyloxy)-3,5-dimethylphenyl]-2-oxoacetate.
What is the SMILES notation for 2-[4-(2,2-dimethylbutanoyloxy)-3,5-dimethylphenyl]-2-oxoacetate?
The canonical SMILES for 2-[4-(2,2-dimethylbutanoyloxy)-3,5-dimethylphenyl]-2-oxoacetate is CCC(C)(C)C(=O)Oc1c(C)cc(C(=O)C(=O)[O-])cc1C.
What is the InChIKey of 2-[4-(2,2-dimethylbutanoyloxy)-3,5-dimethylphenyl]-2-oxoacetate?
The InChIKey is GCVGMGXGHGVAAT-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H20O5/c1-6-16(4,5)15(20)21-13-9(2)7-11(8-10(13)3)12(17)14(18)19/h7-8H,6H2,1-5H3,(H,18,19)/p-1.
What are the key properties of 2-[4-(2,2-dimethylbutanoyloxy)-3,5-dimethylphenyl]-2-oxoacetate?
2-[4-(2,2-dimethylbutanoyloxy)-3,5-dimethylphenyl]-2-oxoacetate has a molecular weight of 291.32 g/mol, XLogP of 1.58, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,2-dimethylbutanoyloxy)-3,5-dimethylphenyl]-2-oxoacetate is sourced from PubChem (CID 23547451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).