C12H10F5O2S+ — CID 23547508
2-(1,4-oxathian-4-ium-4-yl)-1-(2,3,4,5,6-pentafluorophenyl)ethanone (PubChem CID 23547508) has the molecular formula C12H10F5O2S+ and a molecular weight of 313.27 g/mol. Its IUPAC name is 2-(1,4-oxathian-4-ium-4-yl)-1-(2,3,4,5,6-pentafluorophenyl)ethanone.
| Compound Name | 2-(1,4-oxathian-4-ium-4-yl)-1-(2,3,4,5,6-pentafluorophenyl)ethanone |
|---|---|
| PubChem CID | 23547508 |
| Molecular Formula | C12H10F5O2S+ |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 2-(1,4-oxathian-4-ium-4-yl)-1-(2,3,4,5,6-pentafluorophenyl)ethanone |
| SMILES | O=C(C[S+]1CCOCC1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H10F5O2S/c13-8-7(9(14)11(16)12(17)10(8)15)6(18)5-20-3-1-19-2-4-20/h1-5H2/q+1 |
| InChIKey | GORGAIPPIHTSMX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|