C39H61NO9 — CID 23547528
2-[2-cyano-3-(3-ethyl-2,5-dioxooxolan-3-yl)-2-methylpropyl]-4-(2,3-dimethylbutan-2-yloxycarbonyl)-2,4,6,6-tetramethyl-7-oxo-7-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]heptanoic acid (PubChem CID 23547528) has the molecular formula C39H61NO9 and a molecular weight of 687.92 g/mol. Its IUPAC name is 2-[2-cyano-3-(3-ethyl-2,5-dioxooxolan-3-yl)-2-methylpropyl]-4-(2,3-dimethylbutan-2-yloxycarbonyl)-2,4,6,6-tetramethyl-7-oxo-7-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]heptanoic acid.
| Compound Name | 2-[2-cyano-3-(3-ethyl-2,5-dioxooxolan-3-yl)-2-methylpropyl]-4-(2,3-dimethylbutan-2-yloxycarbonyl)-2,4,6,6-tetramethyl-7-oxo-7-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]heptanoic acid |
|---|---|
| PubChem CID | 23547528 |
| Molecular Formula | C39H61NO9 |
| Molecular Weight | 687.92 g/mol |
| Exact Mass | 687.43 |
| IUPAC Name | 2-[2-cyano-3-(3-ethyl-2,5-dioxooxolan-3-yl)-2-methylpropyl]-4-(2,3-dimethylbutan-2-yloxycarbonyl)-2,4,6,6-tetramethyl-7-oxo-7-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]heptanoic acid |
| SMILES | CCC1(CC(C)(C#N)CC(C)(CC(C)(CC(C)(C)C(=O)OC2CC3CCC2(C)C3(C)C)C(=O)OC(C)(C)C(C)C)C(=O)O)CC(=O)OC1=O |
| InChI | InChI=1S/C39H61NO9/c1-14-39(18-27(41)48-31(39)46)21-35(10,23-40)20-36(11,28(42)43)22-37(12,30(45)49-34(8,9)24(2)3)19-32(4,5)29(44)47-26-17-25-15-16-38(26,13)33(25,6)7/h24-26H,14-22H2,1-13H3,(H,42,43) |
| InChIKey | OCJFEJLGJZRSNG-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 157.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.92 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|