C18H18N4O7 — CID 23548149
dimethyl 1-[[3-(4-acetylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]triazole-4,5-dicarboxylate (PubChem CID 23548149) has the molecular formula C18H18N4O7 and a molecular weight of 402.36 g/mol. Its IUPAC name is dimethyl 1-[[3-(4-acetylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]triazole-4,5-dicarboxylate.
| Compound Name | dimethyl 1-[[3-(4-acetylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 23548149 |
| Molecular Formula | C18H18N4O7 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | dimethyl 1-[[3-(4-acetylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]triazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1nnn(CC2CN(c3ccc(C(C)=O)cc3)C(=O)O2)c1C(=O)OC |
| InChI | InChI=1S/C18H18N4O7/c1-10(23)11-4-6-12(7-5-11)21-8-13(29-18(21)26)9-22-15(17(25)28-3)14(19-20-22)16(24)27-2/h4-7,13H,8-9H2,1-3H3 |
| InChIKey | PMIHNVURKOGRLB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 129.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|