C34H50N2O8 — CID 23548154
N-[(13Z)-3-ethyl-2-hydroxy-2,6,8,9,10,16,18-heptamethyl-5,7-dioxo-13-phenylmethoxyimino-4,11,15-trioxabicyclo[8.5.4]nonadecan-17-ylidene]acetamide (PubChem CID 23548154) has the molecular formula C34H50N2O8 and a molecular weight of 614.78 g/mol. Its IUPAC name is N-[(13Z)-3-ethyl-2-hydroxy-2,6,8,9,10,16,18-heptamethyl-5,7-dioxo-13-phenylmethoxyimino-4,11,15-trioxabicyclo[8.5.4]nonadecan-17-ylidene]acetamide.
| Compound Name | N-[(13Z)-3-ethyl-2-hydroxy-2,6,8,9,10,16,18-heptamethyl-5,7-dioxo-13-phenylmethoxyimino-4,11,15-trioxabicyclo[8.5.4]nonadecan-17-ylidene]acetamide |
|---|---|
| PubChem CID | 23548154 |
| Molecular Formula | C34H50N2O8 |
| Molecular Weight | 614.78 g/mol |
| Exact Mass | 614.36 |
| IUPAC Name | N-[(13Z)-3-ethyl-2-hydroxy-2,6,8,9,10,16,18-heptamethyl-5,7-dioxo-13-phenylmethoxyimino-4,11,15-trioxabicyclo[8.5.4]nonadecan-17-ylidene]acetamide |
| SMILES | CCC1OC(=O)C(C)C(=O)C(C)C(C)C2(C)CC(C)/C(=N\C(C)=O)C(C)C(OC/C(=N/OCc3ccccc3)CO2)C1(C)O |
| InChI | InChI=1S/C34H50N2O8/c1-10-28-34(9,40)31-22(4)29(35-25(7)37)20(2)16-33(8,24(6)21(3)30(38)23(5)32(39)44-28)42-19-27(18-41-31)36-43-17-26-14-12-11-13-15-26/h11-15,20-24,28,31,40H,10,16-19H2,1-9H3/b35-29+,36-27- |
| InChIKey | QYRMGPWIDDYEDC-NYQQLYPBSA-N |
| XLogP | 4.95 |
| TPSA | 133.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.78 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|