About 1-benzothiophen-2-ylmethyl N-propan-2-ylcarbamate
1-benzothiophen-2-ylmethyl N-propan-2-ylcarbamate (PubChem CID 23548759) has the molecular formula C13H15NO2S
and a molecular weight of 249.33 g/mol. Its IUPAC name is 1-benzothiophen-2-ylmethyl N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | 1-benzothiophen-2-ylmethyl N-propan-2-ylcarbamate |
| PubChem CID | 23548759 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 1-benzothiophen-2-ylmethyl N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)OCc1cc2ccccc2s1 |
| InChI | InChI=1S/C13H15NO2S/c1-9(2)14-13(15)16-8-11-7-10-5-3-4-6-12(10)17-11/h3-7,9H,8H2,1-2H3,(H,14,15) |
| InChIKey | RJHBAWJMLXKDKU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzothiophen-2-ylmethyl N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophen-2-ylmethyl N-propan-2-ylcarbamate?
The IUPAC name of 1-benzothiophen-2-ylmethyl N-propan-2-ylcarbamate (CID 23548759) is 1-benzothiophen-2-ylmethyl N-propan-2-ylcarbamate.
What is the SMILES notation for 1-benzothiophen-2-ylmethyl N-propan-2-ylcarbamate?
The canonical SMILES for 1-benzothiophen-2-ylmethyl N-propan-2-ylcarbamate is CC(C)NC(=O)OCc1cc2ccccc2s1.
What is the InChIKey of 1-benzothiophen-2-ylmethyl N-propan-2-ylcarbamate?
The InChIKey is RJHBAWJMLXKDKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2S/c1-9(2)14-13(15)16-8-11-7-10-5-3-4-6-12(10)17-11/h3-7,9H,8H2,1-2H3,(H,14,15).
What are the key properties of 1-benzothiophen-2-ylmethyl N-propan-2-ylcarbamate?
1-benzothiophen-2-ylmethyl N-propan-2-ylcarbamate has a molecular weight of 249.33 g/mol, XLogP of 3.54, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophen-2-ylmethyl N-propan-2-ylcarbamate is sourced from PubChem (CID 23548759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).