About 2,3-dihydro-1H-inden-2-yl N-propan-2-ylcarbamate
2,3-dihydro-1H-inden-2-yl N-propan-2-ylcarbamate (PubChem CID 23548773) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-2-yl N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-inden-2-yl N-propan-2-ylcarbamate |
| PubChem CID | 23548773 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2,3-dihydro-1H-inden-2-yl N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)OC1Cc2ccccc2C1 |
| InChI | InChI=1S/C13H17NO2/c1-9(2)14-13(15)16-12-7-10-5-3-4-6-11(10)8-12/h3-6,9,12H,7-8H2,1-2H3,(H,14,15) |
| InChIKey | LZDNZSZZPCLHQE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dihydro-1H-inden-2-yl N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-inden-2-yl N-propan-2-ylcarbamate?
The IUPAC name of 2,3-dihydro-1H-inden-2-yl N-propan-2-ylcarbamate (CID 23548773) is 2,3-dihydro-1H-inden-2-yl N-propan-2-ylcarbamate.
What is the SMILES notation for 2,3-dihydro-1H-inden-2-yl N-propan-2-ylcarbamate?
The canonical SMILES for 2,3-dihydro-1H-inden-2-yl N-propan-2-ylcarbamate is CC(C)NC(=O)OC1Cc2ccccc2C1.
What is the InChIKey of 2,3-dihydro-1H-inden-2-yl N-propan-2-ylcarbamate?
The InChIKey is LZDNZSZZPCLHQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c1-9(2)14-13(15)16-12-7-10-5-3-4-6-11(10)8-12/h3-6,9,12H,7-8H2,1-2H3,(H,14,15).
What are the key properties of 2,3-dihydro-1H-inden-2-yl N-propan-2-ylcarbamate?
2,3-dihydro-1H-inden-2-yl N-propan-2-ylcarbamate has a molecular weight of 219.28 g/mol, XLogP of 2.29, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-inden-2-yl N-propan-2-ylcarbamate is sourced from PubChem (CID 23548773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).