About 2-(4-ethoxycarbonyl-1,1-dioxothian-4-yl)acetic acid
2-(4-ethoxycarbonyl-1,1-dioxothian-4-yl)acetic acid (PubChem CID 23549290) has the molecular formula C10H16O6S
and a molecular weight of 264.30 g/mol. Its IUPAC name is 2-(4-ethoxycarbonyl-1,1-dioxothian-4-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(4-ethoxycarbonyl-1,1-dioxothian-4-yl)acetic acid |
| PubChem CID | 23549290 |
| Molecular Formula | C10H16O6S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-(4-ethoxycarbonyl-1,1-dioxothian-4-yl)acetic acid |
| SMILES | CCOC(=O)C1(CC(=O)O)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H16O6S/c1-2-16-9(13)10(7-8(11)12)3-5-17(14,15)6-4-10/h2-7H2,1H3,(H,11,12) |
| InChIKey | MFNKSNOFGWHTTK-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-ethoxycarbonyl-1,1-dioxothian-4-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethoxycarbonyl-1,1-dioxothian-4-yl)acetic acid?
The IUPAC name of 2-(4-ethoxycarbonyl-1,1-dioxothian-4-yl)acetic acid (CID 23549290) is 2-(4-ethoxycarbonyl-1,1-dioxothian-4-yl)acetic acid.
What is the SMILES notation for 2-(4-ethoxycarbonyl-1,1-dioxothian-4-yl)acetic acid?
The canonical SMILES for 2-(4-ethoxycarbonyl-1,1-dioxothian-4-yl)acetic acid is CCOC(=O)C1(CC(=O)O)CCS(=O)(=O)CC1.
What is the InChIKey of 2-(4-ethoxycarbonyl-1,1-dioxothian-4-yl)acetic acid?
The InChIKey is MFNKSNOFGWHTTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O6S/c1-2-16-9(13)10(7-8(11)12)3-5-17(14,15)6-4-10/h2-7H2,1H3,(H,11,12).
What are the key properties of 2-(4-ethoxycarbonyl-1,1-dioxothian-4-yl)acetic acid?
2-(4-ethoxycarbonyl-1,1-dioxothian-4-yl)acetic acid has a molecular weight of 264.30 g/mol, XLogP of 0.22, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethoxycarbonyl-1,1-dioxothian-4-yl)acetic acid is sourced from PubChem (CID 23549290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).