C15H14F2N2S — CID 23549523
4-[[2-(2,5-difluorophenyl)cyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione (PubChem CID 23549523) has the molecular formula C15H14F2N2S and a molecular weight of 292.35 g/mol. Its IUPAC name is 4-[[2-(2,5-difluorophenyl)cyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-[[2-(2,5-difluorophenyl)cyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 23549523 |
| Molecular Formula | C15H14F2N2S |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 4-[[2-(2,5-difluorophenyl)cyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione |
| SMILES | Fc1ccc(F)c(C2=CCCC2Cc2c[nH]c(=S)[nH]2)c1 |
| InChI | InChI=1S/C15H14F2N2S/c16-10-4-5-14(17)13(7-10)12-3-1-2-9(12)6-11-8-18-15(20)19-11/h3-5,7-9H,1-2,6H2,(H2,18,19,20) |
| InChIKey | GZFWSRYGYHVRQF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|