About 3-(4-methoxyphenyl)-1,1-dimethylurea
3-(4-methoxyphenyl)-1,1-dimethylurea (PubChem CID 23550) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-(4-methoxyphenyl)-1,1-dimethylurea |
| PubChem CID | 23550 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 3-(4-methoxyphenyl)-1,1-dimethylurea |
| SMILES | COc1ccc(NC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C10H14N2O2/c1-12(2)10(13)11-8-4-6-9(14-3)7-5-8/h4-7H,1-3H3,(H,11,13) |
| InChIKey | LCLYWJDPJMDAQN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-methoxyphenyl)-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxyphenyl)-1,1-dimethylurea?
The IUPAC name of 3-(4-methoxyphenyl)-1,1-dimethylurea (CID 23550) is 3-(4-methoxyphenyl)-1,1-dimethylurea.
What is the SMILES notation for 3-(4-methoxyphenyl)-1,1-dimethylurea?
The canonical SMILES for 3-(4-methoxyphenyl)-1,1-dimethylurea is COc1ccc(NC(=O)N(C)C)cc1.
What is the InChIKey of 3-(4-methoxyphenyl)-1,1-dimethylurea?
The InChIKey is LCLYWJDPJMDAQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-12(2)10(13)11-8-4-6-9(14-3)7-5-8/h4-7H,1-3H3,(H,11,13).
What are the key properties of 3-(4-methoxyphenyl)-1,1-dimethylurea?
3-(4-methoxyphenyl)-1,1-dimethylurea has a molecular weight of 194.23 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxyphenyl)-1,1-dimethylurea is sourced from PubChem (CID 23550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).