C17H19FN4O — CID 2355021
N'-(3,4-dihydro-2H-pyrrol-5-yl)-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbohydrazide (PubChem CID 2355021) has the molecular formula C17H19FN4O and a molecular weight of 314.36 g/mol. Its IUPAC name is N'-(3,4-dihydro-2H-pyrrol-5-yl)-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbohydrazide.
| Compound Name | N'-(3,4-dihydro-2H-pyrrol-5-yl)-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbohydrazide |
|---|---|
| PubChem CID | 2355021 |
| Molecular Formula | C17H19FN4O |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | N'-(3,4-dihydro-2H-pyrrol-5-yl)-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC2=NCCC2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H19FN4O/c1-11-10-15(17(23)21-20-16-4-3-9-19-16)12(2)22(11)14-7-5-13(18)6-8-14/h5-8,10H,3-4,9H2,1-2H3,(H,19,20)(H,21,23) |
| InChIKey | AMPHJNNDHHKPDQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|