C18H26N3O7PS — CID 23550216
CID 23550216 (PubChem CID 23550216) has the molecular formula C18H26N3O7PS and a molecular weight of 459.46 g/mol.
| Compound Name | CID 23550216 |
|---|---|
| PubChem CID | 23550216 |
| Molecular Formula | C18H26N3O7PS |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | — |
| SMILES | CC(O)C1C(=O)N2C(CP(=O)=O)=C(SC3CC(C(=O)N(C)C)N(C(=O)O)C3)C(C)C12 |
| InChI | InChI=1S/C18H26N3O7PS/c1-8-14-13(9(2)22)17(24)21(14)12(7-29(27)28)15(8)30-10-5-11(16(23)19(3)4)20(6-10)18(25)26/h8-11,13-14,22H,5-7H2,1-4H3,(H,25,26) |
| InChIKey | GTANUWRROLCBPF-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 135.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|