About 2,7-dimethyl-9,10-dihydrophenanthrene
2,7-dimethyl-9,10-dihydrophenanthrene (PubChem CID 23550290) has the molecular formula C16H16
and a molecular weight of 208.30 g/mol. Its IUPAC name is 2,7-dimethyl-9,10-dihydrophenanthrene.
Molecular Properties
| Compound Name | 2,7-dimethyl-9,10-dihydrophenanthrene |
| PubChem CID | 23550290 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2,7-dimethyl-9,10-dihydrophenanthrene |
| SMILES | Cc1ccc2c(c1)CCc1cc(C)ccc1-2 |
| InChI | InChI=1S/C16H16/c1-11-3-7-15-13(9-11)5-6-14-10-12(2)4-8-16(14)15/h3-4,7-10H,5-6H2,1-2H3 |
| InChIKey | WVJRMHFWLCRDGR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,7-dimethyl-9,10-dihydrophenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethyl-9,10-dihydrophenanthrene?
The IUPAC name of 2,7-dimethyl-9,10-dihydrophenanthrene (CID 23550290) is 2,7-dimethyl-9,10-dihydrophenanthrene.
What is the SMILES notation for 2,7-dimethyl-9,10-dihydrophenanthrene?
The canonical SMILES for 2,7-dimethyl-9,10-dihydrophenanthrene is Cc1ccc2c(c1)CCc1cc(C)ccc1-2.
What is the InChIKey of 2,7-dimethyl-9,10-dihydrophenanthrene?
The InChIKey is WVJRMHFWLCRDGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16/c1-11-3-7-15-13(9-11)5-6-14-10-12(2)4-8-16(14)15/h3-4,7-10H,5-6H2,1-2H3.
What are the key properties of 2,7-dimethyl-9,10-dihydrophenanthrene?
2,7-dimethyl-9,10-dihydrophenanthrene has a molecular weight of 208.30 g/mol, XLogP of 4.07, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethyl-9,10-dihydrophenanthrene is sourced from PubChem (CID 23550290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).