C9H12F7NO2 — CID 23550516
2-fluoro-4-(1,1,2,2,3,3-hexafluoro-3-methoxypropyl)-6-methylmorpholine (PubChem CID 23550516) has the molecular formula C9H12F7NO2 and a molecular weight of 299.19 g/mol. Its IUPAC name is 2-fluoro-4-(1,1,2,2,3,3-hexafluoro-3-methoxypropyl)-6-methylmorpholine.
| Compound Name | 2-fluoro-4-(1,1,2,2,3,3-hexafluoro-3-methoxypropyl)-6-methylmorpholine |
|---|---|
| PubChem CID | 23550516 |
| Molecular Formula | C9H12F7NO2 |
| Molecular Weight | 299.19 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-fluoro-4-(1,1,2,2,3,3-hexafluoro-3-methoxypropyl)-6-methylmorpholine |
| SMILES | COC(F)(F)C(F)(F)C(F)(F)N1CC(C)OC(F)C1 |
| InChI | InChI=1S/C9H12F7NO2/c1-5-3-17(4-6(10)19-5)8(13,14)7(11,12)9(15,16)18-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | QZVKEEBPFJURAM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|