C8H9F10NO2 — CID 23550518
N-[1,1-difluoro-2-(2-fluoroethoxy)ethyl]-N,1,1,2,2,3,3-heptafluoro-3-methoxypropan-1-amine (PubChem CID 23550518) has the molecular formula C8H9F10NO2 and a molecular weight of 341.15 g/mol. Its IUPAC name is N-[1,1-difluoro-2-(2-fluoroethoxy)ethyl]-N,1,1,2,2,3,3-heptafluoro-3-methoxypropan-1-amine.
| Compound Name | N-[1,1-difluoro-2-(2-fluoroethoxy)ethyl]-N,1,1,2,2,3,3-heptafluoro-3-methoxypropan-1-amine |
|---|---|
| PubChem CID | 23550518 |
| Molecular Formula | C8H9F10NO2 |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | N-[1,1-difluoro-2-(2-fluoroethoxy)ethyl]-N,1,1,2,2,3,3-heptafluoro-3-methoxypropan-1-amine |
| SMILES | COC(F)(F)C(F)(F)C(F)(F)N(F)C(F)(F)COCCF |
| InChI | InChI=1S/C8H9F10NO2/c1-20-8(16,17)6(12,13)7(14,15)19(18)5(10,11)4-21-3-2-9/h2-4H2,1H3 |
| InChIKey | IEYNWTWMOVXGJA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|