2-(5,6-dimethylbicyclo[2.2.1]heptane-2-carbonyl)oxyacetic acid

C12H18O4 — CID 23550649

IUPAC2-(5,6-dimethylbicyclo[2.2.1]heptane-2-carbonyl)oxyacetic acid
SMILESCC1C2CC(C(=O)OCC(=O)O)C(C2)C1C
InChIInChI=1S/C12H18O4/c1-6-7(2)9-3-8(6)4-10(9)12(15)16-5-11(13)14/h6-10H,3-5H2,1-2H3,(H,13,14)
InChIKeyBXMROZXVTRBMLE-UHFFFAOYSA-N
MW226.27 g/mol
LogP1.54
Rot. Bonds3

About 2-(5,6-dimethylbicyclo[2.2.1]heptane-2-carbonyl)oxyacetic acid

2-(5,6-dimethylbicyclo[2.2.1]heptane-2-carbonyl)oxyacetic acid (PubChem CID 23550649) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 2-(5,6-dimethylbicyclo[2.2.1]heptane-2-carbonyl)oxyacetic acid.

Molecular Properties

Compound Name2-(5,6-dimethylbicyclo[2.2.1]heptane-2-carbonyl)oxyacetic acid
PubChem CID23550649
Molecular FormulaC12H18O4
Molecular Weight226.27 g/mol
Exact Mass226.12
IUPAC Name2-(5,6-dimethylbicyclo[2.2.1]heptane-2-carbonyl)oxyacetic acid
SMILESCC1C2CC(C(=O)OCC(=O)O)C(C2)C1C
InChIInChI=1S/C12H18O4/c1-6-7(2)9-3-8(6)4-10(9)12(15)16-5-11(13)14/h6-10H,3-5H2,1-2H3,(H,13,14)
InChIKeyBXMROZXVTRBMLE-UHFFFAOYSA-N
XLogP1.54
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.27
LogP ≤ 51.54
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(5,6-dimethylbicyclo[2.2.1]heptane-2-carbonyl)oxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5,6-dimethylbicyclo[2.2.1]heptane-2-carbonyl)oxyacetic acid?
The IUPAC name of 2-(5,6-dimethylbicyclo[2.2.1]heptane-2-carbonyl)oxyacetic acid (CID 23550649) is 2-(5,6-dimethylbicyclo[2.2.1]heptane-2-carbonyl)oxyacetic acid.
What is the SMILES notation for 2-(5,6-dimethylbicyclo[2.2.1]heptane-2-carbonyl)oxyacetic acid?
The canonical SMILES for 2-(5,6-dimethylbicyclo[2.2.1]heptane-2-carbonyl)oxyacetic acid is CC1C2CC(C(=O)OCC(=O)O)C(C2)C1C.
What is the InChIKey of 2-(5,6-dimethylbicyclo[2.2.1]heptane-2-carbonyl)oxyacetic acid?
The InChIKey is BXMROZXVTRBMLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4/c1-6-7(2)9-3-8(6)4-10(9)12(15)16-5-11(13)14/h6-10H,3-5H2,1-2H3,(H,13,14).
What are the key properties of 2-(5,6-dimethylbicyclo[2.2.1]heptane-2-carbonyl)oxyacetic acid?
2-(5,6-dimethylbicyclo[2.2.1]heptane-2-carbonyl)oxyacetic acid has a molecular weight of 226.27 g/mol, XLogP of 1.54, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,6-dimethylbicyclo[2.2.1]heptane-2-carbonyl)oxyacetic acid is sourced from PubChem (CID 23550649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).