C19H26O4 — CID 23550739
(2-oxooxolan-3-yl) 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 23550739) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | (2-oxooxolan-3-yl) 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 23550739 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (2-oxooxolan-3-yl) 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CC1C(C)C2CC1C1C3CC(C(=O)OC4CCOC4=O)C(C3)C21 |
| InChI | InChI=1S/C19H26O4/c1-8-9(2)12-7-11(8)16-10-5-13(17(12)16)14(6-10)18(20)23-15-3-4-22-19(15)21/h8-17H,3-7H2,1-2H3 |
| InChIKey | AIVMWYOQAADUAG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|