C32H48O5 — CID 23550758
4-O-(2-adamantyl) 5-O-[1-(2-methylpropoxy)ethyl] 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4,5-dicarboxylate (PubChem CID 23550758) has the molecular formula C32H48O5 and a molecular weight of 512.73 g/mol. Its IUPAC name is 4-O-(2-adamantyl) 5-O-[1-(2-methylpropoxy)ethyl] 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4,5-dicarboxylate.
| Compound Name | 4-O-(2-adamantyl) 5-O-[1-(2-methylpropoxy)ethyl] 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 23550758 |
| Molecular Formula | C32H48O5 |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.35 |
| IUPAC Name | 4-O-(2-adamantyl) 5-O-[1-(2-methylpropoxy)ethyl] 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4,5-dicarboxylate |
| SMILES | CC(C)COC(C)OC(=O)C1C2CC(C1C(=O)OC1C3CC4CC(C3)CC1C4)C1C3CC(C(C)C3C)C21 |
| InChI | InChI=1S/C32H48O5/c1-14(2)13-35-17(5)36-31(33)28-24-12-25(27-23-11-22(26(24)27)15(3)16(23)4)29(28)32(34)37-30-20-7-18-6-19(9-20)10-21(30)8-18/h14-30H,6-13H2,1-5H3 |
| InChIKey | WFNLOKAPNDQTSA-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|