C29H42O5 — CID 23550788
5-O-(2-adamantyl) 4-O-(ethoxymethyl) 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4,5-dicarboxylate (PubChem CID 23550788) has the molecular formula C29H42O5 and a molecular weight of 470.65 g/mol. Its IUPAC name is 5-O-(2-adamantyl) 4-O-(ethoxymethyl) 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4,5-dicarboxylate.
| Compound Name | 5-O-(2-adamantyl) 4-O-(ethoxymethyl) 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 23550788 |
| Molecular Formula | C29H42O5 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | 5-O-(2-adamantyl) 4-O-(ethoxymethyl) 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4,5-dicarboxylate |
| SMILES | CCOCOC(=O)C1C2CC(C1C(=O)OC1C3CC4CC(C3)CC1C4)C1C3CC(C(C)C3C)C21 |
| InChI | InChI=1S/C29H42O5/c1-4-32-12-33-28(30)25-21-11-22(24-20-10-19(23(21)24)13(2)14(20)3)26(25)29(31)34-27-17-6-15-5-16(8-17)9-18(27)7-15/h13-27H,4-12H2,1-3H3 |
| InChIKey | BPCQTOYPOSTTSC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|