About (1-methylpiperidin-4-yl) 4-(butylamino)benzoate
(1-methylpiperidin-4-yl) 4-(butylamino)benzoate (PubChem CID 23551) has the molecular formula C17H26N2O2
and a molecular weight of 290.41 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) 4-(butylamino)benzoate.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl) 4-(butylamino)benzoate |
| PubChem CID | 23551 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (1-methylpiperidin-4-yl) 4-(butylamino)benzoate |
| SMILES | CCCCNc1ccc(C(=O)OC2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C17H26N2O2/c1-3-4-11-18-15-7-5-14(6-8-15)17(20)21-16-9-12-19(2)13-10-16/h5-8,16,18H,3-4,9-13H2,1-2H3 |
| InChIKey | AROAGUCPXICSGW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1-methylpiperidin-4-yl) 4-(butylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl) 4-(butylamino)benzoate?
The IUPAC name of (1-methylpiperidin-4-yl) 4-(butylamino)benzoate (CID 23551) is (1-methylpiperidin-4-yl) 4-(butylamino)benzoate.
What is the SMILES notation for (1-methylpiperidin-4-yl) 4-(butylamino)benzoate?
The canonical SMILES for (1-methylpiperidin-4-yl) 4-(butylamino)benzoate is CCCCNc1ccc(C(=O)OC2CCN(C)CC2)cc1.
What is the InChIKey of (1-methylpiperidin-4-yl) 4-(butylamino)benzoate?
The InChIKey is AROAGUCPXICSGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O2/c1-3-4-11-18-15-7-5-14(6-8-15)17(20)21-16-9-12-19(2)13-10-16/h5-8,16,18H,3-4,9-13H2,1-2H3.
What are the key properties of (1-methylpiperidin-4-yl) 4-(butylamino)benzoate?
(1-methylpiperidin-4-yl) 4-(butylamino)benzoate has a molecular weight of 290.41 g/mol, XLogP of 3.15, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl) 4-(butylamino)benzoate is sourced from PubChem (CID 23551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).