methyl 4-(5-methyldodecan-2-yl)benzenesulfonate

C20H34O3S — CID 23551142

IUPACmethyl 4-(5-methyldodecan-2-yl)benzenesulfonate
SMILESCCCCCCCC(C)CCC(C)c1ccc(S(=O)(=O)OC)cc1
InChIInChI=1S/C20H34O3S/c1-5-6-7-8-9-10-17(2)11-12-18(3)19-13-15-20(16-14-19)24(21,22)23-4/h13-18H,5-12H2,1-4H3
InChIKeyXFMFCWVPCFIRTR-UHFFFAOYSA-N
MW354.56 g/mol
LogP5.90
Rot. Bonds12

About methyl 4-(5-methyldodecan-2-yl)benzenesulfonate

methyl 4-(5-methyldodecan-2-yl)benzenesulfonate (PubChem CID 23551142) has the molecular formula C20H34O3S and a molecular weight of 354.56 g/mol. Its IUPAC name is methyl 4-(5-methyldodecan-2-yl)benzenesulfonate.

Molecular Properties

Compound Namemethyl 4-(5-methyldodecan-2-yl)benzenesulfonate
PubChem CID23551142
Molecular FormulaC20H34O3S
Molecular Weight354.56 g/mol
Exact Mass354.22
IUPAC Namemethyl 4-(5-methyldodecan-2-yl)benzenesulfonate
SMILESCCCCCCCC(C)CCC(C)c1ccc(S(=O)(=O)OC)cc1
InChIInChI=1S/C20H34O3S/c1-5-6-7-8-9-10-17(2)11-12-18(3)19-13-15-20(16-14-19)24(21,22)23-4/h13-18H,5-12H2,1-4H3
InChIKeyXFMFCWVPCFIRTR-UHFFFAOYSA-N
XLogP5.90
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds12
Heavy Atoms24
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500354.56
LogP ≤ 55.90
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}

Analyze methyl 4-(5-methyldodecan-2-yl)benzenesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(5-methyldodecan-2-yl)benzenesulfonate?
The IUPAC name of methyl 4-(5-methyldodecan-2-yl)benzenesulfonate (CID 23551142) is methyl 4-(5-methyldodecan-2-yl)benzenesulfonate.
What is the SMILES notation for methyl 4-(5-methyldodecan-2-yl)benzenesulfonate?
The canonical SMILES for methyl 4-(5-methyldodecan-2-yl)benzenesulfonate is CCCCCCCC(C)CCC(C)c1ccc(S(=O)(=O)OC)cc1.
What is the InChIKey of methyl 4-(5-methyldodecan-2-yl)benzenesulfonate?
The InChIKey is XFMFCWVPCFIRTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O3S/c1-5-6-7-8-9-10-17(2)11-12-18(3)19-13-15-20(16-14-19)24(21,22)23-4/h13-18H,5-12H2,1-4H3.
What are the key properties of methyl 4-(5-methyldodecan-2-yl)benzenesulfonate?
methyl 4-(5-methyldodecan-2-yl)benzenesulfonate has a molecular weight of 354.56 g/mol, XLogP of 5.90, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(5-methyldodecan-2-yl)benzenesulfonate is sourced from PubChem (CID 23551142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).