2-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)acetic acid

C7H11NO4 — CID 23551399

IUPAC2-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)acetic acid
SMILESCCC1CN(CC(=O)O)C(=O)O1
InChIInChI=1S/C7H11NO4/c1-2-5-3-8(4-6(9)10)7(11)12-5/h5H,2-4H2,1H3,(H,9,10)
InChIKeyISAGNOYGRXMOFU-UHFFFAOYSA-N
MW173.17 g/mol
LogP0.30
Rot. Bonds3

About 2-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)acetic acid

2-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)acetic acid (PubChem CID 23551399) has the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. Its IUPAC name is 2-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)acetic acid.

Molecular Properties

Compound Name2-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)acetic acid
PubChem CID23551399
Molecular FormulaC7H11NO4
Molecular Weight173.17 g/mol
Exact Mass173.07
IUPAC Name2-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)acetic acid
SMILESCCC1CN(CC(=O)O)C(=O)O1
InChIInChI=1S/C7H11NO4/c1-2-5-3-8(4-6(9)10)7(11)12-5/h5H,2-4H2,1H3,(H,9,10)
InChIKeyISAGNOYGRXMOFU-UHFFFAOYSA-N
XLogP0.30
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.17
LogP ≤ 50.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)acetic acid?
The IUPAC name of 2-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)acetic acid (CID 23551399) is 2-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)acetic acid.
What is the SMILES notation for 2-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)acetic acid?
The canonical SMILES for 2-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)acetic acid is CCC1CN(CC(=O)O)C(=O)O1.
What is the InChIKey of 2-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)acetic acid?
The InChIKey is ISAGNOYGRXMOFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO4/c1-2-5-3-8(4-6(9)10)7(11)12-5/h5H,2-4H2,1H3,(H,9,10).
What are the key properties of 2-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)acetic acid?
2-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)acetic acid has a molecular weight of 173.17 g/mol, XLogP of 0.30, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)acetic acid is sourced from PubChem (CID 23551399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).