C14H13NO3S — CID 2355161
[2-(benzylamino)-2-oxoethyl] thiophene-2-carboxylate (PubChem CID 2355161) has the molecular formula C14H13NO3S and a molecular weight of 275.33 g/mol. Its IUPAC name is [2-(benzylamino)-2-oxoethyl] thiophene-2-carboxylate.
| Compound Name | [2-(benzylamino)-2-oxoethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 2355161 |
| Molecular Formula | C14H13NO3S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | [2-(benzylamino)-2-oxoethyl] thiophene-2-carboxylate |
| SMILES | O=C(COC(=O)c1cccs1)NCc1ccccc1 |
| InChI | InChI=1S/C14H13NO3S/c16-13(15-9-11-5-2-1-3-6-11)10-18-14(17)12-7-4-8-19-12/h1-8H,9-10H2,(H,15,16) |
| InChIKey | IRFCNPJCZSVVRP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |