C45H44ClN5O2 — CID 23551954
4-(1-tritylimidazol-4-yl)butyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazine-1-carboxylate (PubChem CID 23551954) has the molecular formula C45H44ClN5O2 and a molecular weight of 722.33 g/mol. Its IUPAC name is 4-(1-tritylimidazol-4-yl)butyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazine-1-carboxylate.
| Compound Name | 4-(1-tritylimidazol-4-yl)butyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 23551954 |
| Molecular Formula | C45H44ClN5O2 |
| Molecular Weight | 722.33 g/mol |
| Exact Mass | 721.32 |
| IUPAC Name | 4-(1-tritylimidazol-4-yl)butyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazine-1-carboxylate |
| SMILES | O=C(OCCCCc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)N1CCN(C2c3ccc(Cl)cc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C45H44ClN5O2/c46-39-23-24-41-35(31-39)22-21-34-13-12-25-47-42(34)43(41)49-26-28-50(29-27-49)44(52)53-30-11-10-20-40-32-51(33-48-40)45(36-14-4-1-5-15-36,37-16-6-2-7-17-37)38-18-8-3-9-19-38/h1-9,12-19,23-25,31-33,43H,10-11,20-22,26-30H2 |
| InChIKey | OMVNHFLYHFESFC-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.33 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|