About 4,5-ditert-butyl-2-propyl-1,3-dihydropyridazin-6-one
4,5-ditert-butyl-2-propyl-1,3-dihydropyridazin-6-one (PubChem CID 23552367) has the molecular formula C15H28N2O
and a molecular weight of 252.40 g/mol. Its IUPAC name is 4,5-ditert-butyl-2-propyl-1,3-dihydropyridazin-6-one.
Molecular Properties
| Compound Name | 4,5-ditert-butyl-2-propyl-1,3-dihydropyridazin-6-one |
| PubChem CID | 23552367 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 4,5-ditert-butyl-2-propyl-1,3-dihydropyridazin-6-one |
| SMILES | CCCN1CC(C(C)(C)C)=C(C(C)(C)C)C(=O)N1 |
| InChI | InChI=1S/C15H28N2O/c1-8-9-17-10-11(14(2,3)4)12(13(18)16-17)15(5,6)7/h8-10H2,1-7H3,(H,16,18) |
| InChIKey | GVWIGJRUEZUZDJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-ditert-butyl-2-propyl-1,3-dihydropyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-ditert-butyl-2-propyl-1,3-dihydropyridazin-6-one?
The IUPAC name of 4,5-ditert-butyl-2-propyl-1,3-dihydropyridazin-6-one (CID 23552367) is 4,5-ditert-butyl-2-propyl-1,3-dihydropyridazin-6-one.
What is the SMILES notation for 4,5-ditert-butyl-2-propyl-1,3-dihydropyridazin-6-one?
The canonical SMILES for 4,5-ditert-butyl-2-propyl-1,3-dihydropyridazin-6-one is CCCN1CC(C(C)(C)C)=C(C(C)(C)C)C(=O)N1.
What is the InChIKey of 4,5-ditert-butyl-2-propyl-1,3-dihydropyridazin-6-one?
The InChIKey is GVWIGJRUEZUZDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O/c1-8-9-17-10-11(14(2,3)4)12(13(18)16-17)15(5,6)7/h8-10H2,1-7H3,(H,16,18).
What are the key properties of 4,5-ditert-butyl-2-propyl-1,3-dihydropyridazin-6-one?
4,5-ditert-butyl-2-propyl-1,3-dihydropyridazin-6-one has a molecular weight of 252.40 g/mol, XLogP of 3.13, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-ditert-butyl-2-propyl-1,3-dihydropyridazin-6-one is sourced from PubChem (CID 23552367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).