C15H25NO3 — CID 23552395
5,6-ditert-butyl-3-propyl-1,3-oxazine-2,4-dione (PubChem CID 23552395) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 5,6-ditert-butyl-3-propyl-1,3-oxazine-2,4-dione.
| Compound Name | 5,6-ditert-butyl-3-propyl-1,3-oxazine-2,4-dione |
|---|---|
| PubChem CID | 23552395 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 5,6-ditert-butyl-3-propyl-1,3-oxazine-2,4-dione |
| SMILES | CCCn1c(=O)oc(C(C)(C)C)c(C(C)(C)C)c1=O |
| InChI | InChI=1S/C15H25NO3/c1-8-9-16-12(17)10(14(2,3)4)11(15(5,6)7)19-13(16)18/h8-9H2,1-7H3 |
| InChIKey | HBFYOLFDWHOVEH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |