C16H27NO3 — CID 23552417
6,7-ditert-butyl-4-propyl-1,4-oxazepine-3,5-dione (PubChem CID 23552417) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 6,7-ditert-butyl-4-propyl-1,4-oxazepine-3,5-dione.
| Compound Name | 6,7-ditert-butyl-4-propyl-1,4-oxazepine-3,5-dione |
|---|---|
| PubChem CID | 23552417 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 6,7-ditert-butyl-4-propyl-1,4-oxazepine-3,5-dione |
| SMILES | CCCN1C(=O)COC(C(C)(C)C)=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C16H27NO3/c1-8-9-17-11(18)10-20-13(16(5,6)7)12(14(17)19)15(2,3)4/h8-10H2,1-7H3 |
| InChIKey | FVSUWRAZZMZBQK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|