C16H30N2O — CID 23552419
6,7-ditert-butyl-4-propyl-3,5-dihydro-1H-1,4-diazepin-2-one (PubChem CID 23552419) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 6,7-ditert-butyl-4-propyl-3,5-dihydro-1H-1,4-diazepin-2-one.
| Compound Name | 6,7-ditert-butyl-4-propyl-3,5-dihydro-1H-1,4-diazepin-2-one |
|---|---|
| PubChem CID | 23552419 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 6,7-ditert-butyl-4-propyl-3,5-dihydro-1H-1,4-diazepin-2-one |
| SMILES | CCCN1CC(=O)NC(C(C)(C)C)=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C16H30N2O/c1-8-9-18-10-12(15(2,3)4)14(16(5,6)7)17-13(19)11-18/h8-11H2,1-7H3,(H,17,19) |
| InChIKey | HDUHRBZYDYVHHL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |