About 3-[2-(4-benzylphenoxy)ethyl]-5-oxidoimidazo[4,5-c]pyridin-5-ium
3-[2-(4-benzylphenoxy)ethyl]-5-oxidoimidazo[4,5-c]pyridin-5-ium (PubChem CID 23553328) has the molecular formula C21H19N3O2
and a molecular weight of 345.40 g/mol. Its IUPAC name is 3-[2-(4-benzylphenoxy)ethyl]-5-oxidoimidazo[4,5-c]pyridin-5-ium.
Molecular Properties
| Compound Name | 3-[2-(4-benzylphenoxy)ethyl]-5-oxidoimidazo[4,5-c]pyridin-5-ium |
| PubChem CID | 23553328 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 3-[2-(4-benzylphenoxy)ethyl]-5-oxidoimidazo[4,5-c]pyridin-5-ium |
| SMILES | [O-][n+]1ccc2ncn(CCOc3ccc(Cc4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C21H19N3O2/c25-24-11-10-20-21(15-24)23(16-22-20)12-13-26-19-8-6-18(7-9-19)14-17-4-2-1-3-5-17/h1-11,15-16H,12-14H2 |
| InChIKey | OBCNLXQJCDOCAL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(4-benzylphenoxy)ethyl]-5-oxidoimidazo[4,5-c]pyridin-5-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(4-benzylphenoxy)ethyl]-5-oxidoimidazo[4,5-c]pyridin-5-ium?
The IUPAC name of 3-[2-(4-benzylphenoxy)ethyl]-5-oxidoimidazo[4,5-c]pyridin-5-ium (CID 23553328) is 3-[2-(4-benzylphenoxy)ethyl]-5-oxidoimidazo[4,5-c]pyridin-5-ium.
What is the SMILES notation for 3-[2-(4-benzylphenoxy)ethyl]-5-oxidoimidazo[4,5-c]pyridin-5-ium?
The canonical SMILES for 3-[2-(4-benzylphenoxy)ethyl]-5-oxidoimidazo[4,5-c]pyridin-5-ium is [O-][n+]1ccc2ncn(CCOc3ccc(Cc4ccccc4)cc3)c2c1.
What is the InChIKey of 3-[2-(4-benzylphenoxy)ethyl]-5-oxidoimidazo[4,5-c]pyridin-5-ium?
The InChIKey is OBCNLXQJCDOCAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O2/c25-24-11-10-20-21(15-24)23(16-22-20)12-13-26-19-8-6-18(7-9-19)14-17-4-2-1-3-5-17/h1-11,15-16H,12-14H2.
What are the key properties of 3-[2-(4-benzylphenoxy)ethyl]-5-oxidoimidazo[4,5-c]pyridin-5-ium?
3-[2-(4-benzylphenoxy)ethyl]-5-oxidoimidazo[4,5-c]pyridin-5-ium has a molecular weight of 345.40 g/mol, XLogP of 3.34, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4-benzylphenoxy)ethyl]-5-oxidoimidazo[4,5-c]pyridin-5-ium is sourced from PubChem (CID 23553328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).