C25H33NO3 — CID 23553361
ethyl 3-[4-(4-benzylphenoxy)butyl-prop-2-enylamino]propanoate (PubChem CID 23553361) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is ethyl 3-[4-(4-benzylphenoxy)butyl-prop-2-enylamino]propanoate.
| Compound Name | ethyl 3-[4-(4-benzylphenoxy)butyl-prop-2-enylamino]propanoate |
|---|---|
| PubChem CID | 23553361 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | ethyl 3-[4-(4-benzylphenoxy)butyl-prop-2-enylamino]propanoate |
| SMILES | C=CCN(CCCCOc1ccc(Cc2ccccc2)cc1)CCC(=O)OCC |
| InChI | InChI=1S/C25H33NO3/c1-3-17-26(19-16-25(27)28-4-2)18-8-9-20-29-24-14-12-23(13-15-24)21-22-10-6-5-7-11-22/h3,5-7,10-15H,1,4,8-9,16-21H2,2H3 |
| InChIKey | LMLQFWVBNFKHML-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|