About 1-(2-phenoxyphenyl)-3,4-bis(4-phenoxyphenyl)pyrrole-2,5-dione
1-(2-phenoxyphenyl)-3,4-bis(4-phenoxyphenyl)pyrrole-2,5-dione (PubChem CID 23553867) has the molecular formula C40H27NO5
and a molecular weight of 601.66 g/mol. Its IUPAC name is 1-(2-phenoxyphenyl)-3,4-bis(4-phenoxyphenyl)pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-(2-phenoxyphenyl)-3,4-bis(4-phenoxyphenyl)pyrrole-2,5-dione |
| PubChem CID | 23553867 |
| Molecular Formula | C40H27NO5 |
| Molecular Weight | 601.66 g/mol |
| Exact Mass | 601.19 |
| IUPAC Name | 1-(2-phenoxyphenyl)-3,4-bis(4-phenoxyphenyl)pyrrole-2,5-dione |
| SMILES | O=C1C(c2ccc(Oc3ccccc3)cc2)=C(c2ccc(Oc3ccccc3)cc2)C(=O)N1c1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C40H27NO5/c42-39-37(28-20-24-33(25-21-28)44-30-12-4-1-5-13-30)38(29-22-26-34(27-23-29)45-31-14-6-2-7-15-31)40(43)41(39)35-18-10-11-19-36(35)46-32-16-8-3-9-17-32/h1-27H |
| InChIKey | JWSCETLVFJHFCL-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 601.66 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-phenoxyphenyl)-3,4-bis(4-phenoxyphenyl)pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-phenoxyphenyl)-3,4-bis(4-phenoxyphenyl)pyrrole-2,5-dione?
The IUPAC name of 1-(2-phenoxyphenyl)-3,4-bis(4-phenoxyphenyl)pyrrole-2,5-dione (CID 23553867) is 1-(2-phenoxyphenyl)-3,4-bis(4-phenoxyphenyl)pyrrole-2,5-dione.
What is the SMILES notation for 1-(2-phenoxyphenyl)-3,4-bis(4-phenoxyphenyl)pyrrole-2,5-dione?
The canonical SMILES for 1-(2-phenoxyphenyl)-3,4-bis(4-phenoxyphenyl)pyrrole-2,5-dione is O=C1C(c2ccc(Oc3ccccc3)cc2)=C(c2ccc(Oc3ccccc3)cc2)C(=O)N1c1ccccc1Oc1ccccc1.
What is the InChIKey of 1-(2-phenoxyphenyl)-3,4-bis(4-phenoxyphenyl)pyrrole-2,5-dione?
The InChIKey is JWSCETLVFJHFCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H27NO5/c42-39-37(28-20-24-33(25-21-28)44-30-12-4-1-5-13-30)38(29-22-26-34(27-23-29)45-31-14-6-2-7-15-31)40(43)41(39)35-18-10-11-19-36(35)46-32-16-8-3-9-17-32/h1-27H.
What are the key properties of 1-(2-phenoxyphenyl)-3,4-bis(4-phenoxyphenyl)pyrrole-2,5-dione?
1-(2-phenoxyphenyl)-3,4-bis(4-phenoxyphenyl)pyrrole-2,5-dione has a molecular weight of 601.66 g/mol, XLogP of 9.55, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-phenoxyphenyl)-3,4-bis(4-phenoxyphenyl)pyrrole-2,5-dione is sourced from PubChem (CID 23553867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).