C20H34ClN5O14 — CID 23553917
2-(4-chlorophenyl)-1-(diaminomethylidene)guanidine;bis((2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid) (PubChem CID 23553917) has the molecular formula C20H34ClN5O14 and a molecular weight of 603.97 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(diaminomethylidene)guanidine;bis((2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid).
| Compound Name | 2-(4-chlorophenyl)-1-(diaminomethylidene)guanidine;bis((2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid) |
|---|---|
| PubChem CID | 23553917 |
| Molecular Formula | C20H34ClN5O14 |
| Molecular Weight | 603.97 g/mol |
| Exact Mass | 603.18 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(diaminomethylidene)guanidine;bis((2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid) |
| SMILES | NC(N)=N/C(N)=N/c1ccc(Cl)cc1.O=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H10ClN5.2C6H12O7/c9-5-1-3-6(4-2-5)13-8(12)14-7(10)11;2*7-1-2(8)3(9)4(10)5(11)6(12)13/h1-4H,(H6,10,11,12,13,14);2*2-5,7-11H,1H2,(H,12,13)/t;2*2-,3-,4+,5-/m.11/s1 |
| InChIKey | QIQIRGIBDRMSAP-UUPCJSQJSA-N |
| XLogP | -6.43 |
| TPSA | 379.68 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.97 |
| LogP ≤ 5 | -6.43 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|