C22H28N4O5 — CID 23553982
5-[(2E,4E)-5-(1,3-diethyl-4-methyl-2,6-dioxopyrimidin-5-yl)penta-2,4-dienylidene]-1,3-diethyl-1,3-diazinane-2,4,6-trione (PubChem CID 23553982) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is 5-[(2E,4E)-5-(1,3-diethyl-4-methyl-2,6-dioxopyrimidin-5-yl)penta-2,4-dienylidene]-1,3-diethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(2E,4E)-5-(1,3-diethyl-4-methyl-2,6-dioxopyrimidin-5-yl)penta-2,4-dienylidene]-1,3-diethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 23553982 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 5-[(2E,4E)-5-(1,3-diethyl-4-methyl-2,6-dioxopyrimidin-5-yl)penta-2,4-dienylidene]-1,3-diethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCN1C(=O)C(=C/C=C/C=C/c2c(C)n(CC)c(=O)n(CC)c2=O)C(=O)N(CC)C1=O |
| InChI | InChI=1S/C22H28N4O5/c1-6-23-15(5)16(18(27)24(7-2)21(23)30)13-11-10-12-14-17-19(28)25(8-3)22(31)26(9-4)20(17)29/h10-14H,6-9H2,1-5H3/b12-10+,13-11+ |
| InChIKey | FSPTVOYYVSUHKA-DCIPZJNNSA-N |
| XLogP | 1.68 |
| TPSA | 101.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|